C25H33FN2O2 — CID 22843999
(2E,4Z)-4-fluoro-N-(2-methylpropyl)-12-quinolin-2-yloxydodeca-2,4-dienamide (PubChem CID 22843999) has the molecular formula C25H33FN2O2 and a molecular weight of 412.55 g/mol. Its IUPAC name is (2E,4Z)-4-fluoro-N-(2-methylpropyl)-12-quinolin-2-yloxydodeca-2,4-dienamide.
| Compound Name | (2E,4Z)-4-fluoro-N-(2-methylpropyl)-12-quinolin-2-yloxydodeca-2,4-dienamide |
|---|---|
| PubChem CID | 22843999 |
| Molecular Formula | C25H33FN2O2 |
| Molecular Weight | 412.55 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | (2E,4Z)-4-fluoro-N-(2-methylpropyl)-12-quinolin-2-yloxydodeca-2,4-dienamide |
| SMILES | CC(C)CNC(=O)/C=C/C(F)=C/CCCCCCCOc1ccc2ccccc2n1 |
| InChI | InChI=1S/C25H33FN2O2/c1-20(2)19-27-24(29)16-15-22(26)12-7-5-3-4-6-10-18-30-25-17-14-21-11-8-9-13-23(21)28-25/h8-9,11-17,20H,3-7,10,18-19H2,1-2H3,(H,27,29)/b16-15+,22-12- |
| InChIKey | LWVULCNJVQLNAB-DQXZJOGVSA-N |
| XLogP | 6.14 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.55 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|