C22H25F2NO3 — CID 86745843
methyl (2Z,4Z)-2,4-difluoro-12-quinolin-2-yloxydodeca-2,4-dienoate (PubChem CID 86745843) has the molecular formula C22H25F2NO3 and a molecular weight of 389.44 g/mol. Its IUPAC name is methyl (2Z,4Z)-2,4-difluoro-12-quinolin-2-yloxydodeca-2,4-dienoate.
| Compound Name | methyl (2Z,4Z)-2,4-difluoro-12-quinolin-2-yloxydodeca-2,4-dienoate |
|---|---|
| PubChem CID | 86745843 |
| Molecular Formula | C22H25F2NO3 |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | methyl (2Z,4Z)-2,4-difluoro-12-quinolin-2-yloxydodeca-2,4-dienoate |
| SMILES | COC(=O)/C(F)=C/C(F)=C/CCCCCCCOc1ccc2ccccc2n1 |
| InChI | InChI=1S/C22H25F2NO3/c1-27-22(26)19(24)16-18(23)11-6-4-2-3-5-9-15-28-21-14-13-17-10-7-8-12-20(17)25-21/h7-8,10-14,16H,2-6,9,15H2,1H3/b18-11-,19-16- |
| InChIKey | XSHNPTWQDWCWGJ-GVPHMVRHSA-N |
| XLogP | 5.83 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|