C25H34N2OS — CID 54155202
N-(2-methylpropyl)-12-quinolin-2-yloxydodeca-2,4-dienethioamide (PubChem CID 54155202) has the molecular formula C25H34N2OS and a molecular weight of 410.63 g/mol. Its IUPAC name is N-(2-methylpropyl)-12-quinolin-2-yloxydodeca-2,4-dienethioamide.
| Compound Name | N-(2-methylpropyl)-12-quinolin-2-yloxydodeca-2,4-dienethioamide |
|---|---|
| PubChem CID | 54155202 |
| Molecular Formula | C25H34N2OS |
| Molecular Weight | 410.63 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | N-(2-methylpropyl)-12-quinolin-2-yloxydodeca-2,4-dienethioamide |
| SMILES | CC(C)CNC(=S)C=CC=CCCCCCCCOc1ccc2ccccc2n1 |
| InChI | InChI=1S/C25H34N2OS/c1-21(2)20-26-25(29)16-10-8-6-4-3-5-7-9-13-19-28-24-18-17-22-14-11-12-15-23(22)27-24/h6,8,10-12,14-18,21H,3-5,7,9,13,19-20H2,1-2H3,(H,26,29) |
| InChIKey | OKOGHQCERUCFRU-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.63 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|