C23H28FNO2 — CID 173408172
9-(7-fluoronaphthalen-1-yl)oxy-N-(2-methylpropyl)nona-2,4-dienamide (PubChem CID 173408172) has the molecular formula C23H28FNO2 and a molecular weight of 369.48 g/mol. Its IUPAC name is 9-(7-fluoronaphthalen-1-yl)oxy-N-(2-methylpropyl)nona-2,4-dienamide.
| Compound Name | 9-(7-fluoronaphthalen-1-yl)oxy-N-(2-methylpropyl)nona-2,4-dienamide |
|---|---|
| PubChem CID | 173408172 |
| Molecular Formula | C23H28FNO2 |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 9-(7-fluoronaphthalen-1-yl)oxy-N-(2-methylpropyl)nona-2,4-dienamide |
| SMILES | CC(C)CNC(=O)C=CC=CCCCCOc1cccc2ccc(F)cc12 |
| InChI | InChI=1S/C23H28FNO2/c1-18(2)17-25-23(26)12-7-5-3-4-6-8-15-27-22-11-9-10-19-13-14-20(24)16-21(19)22/h3,5,7,9-14,16,18H,4,6,8,15,17H2,1-2H3,(H,25,26) |
| InChIKey | INKDADFUGSEEPH-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|