C21H31NO2 — CID 88710784
(2E,4E)-N-(2-methylpropyl)-9-(1-phenylethoxy)nona-2,4-dienamide (PubChem CID 88710784) has the molecular formula C21H31NO2 and a molecular weight of 329.48 g/mol. Its IUPAC name is (2E,4E)-N-(2-methylpropyl)-9-(1-phenylethoxy)nona-2,4-dienamide.
| Compound Name | (2E,4E)-N-(2-methylpropyl)-9-(1-phenylethoxy)nona-2,4-dienamide |
|---|---|
| PubChem CID | 88710784 |
| Molecular Formula | C21H31NO2 |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | (2E,4E)-N-(2-methylpropyl)-9-(1-phenylethoxy)nona-2,4-dienamide |
| SMILES | CC(C)CNC(=O)/C=C/C=C/CCCCOC(C)c1ccccc1 |
| InChI | InChI=1S/C21H31NO2/c1-18(2)17-22-21(23)15-11-6-4-5-7-12-16-24-19(3)20-13-9-8-10-14-20/h4,6,8-11,13-15,18-19H,5,7,12,16-17H2,1-3H3,(H,22,23)/b6-4+,15-11+ |
| InChIKey | MIKCREPFMJUQRC-OKOYHYLBSA-N |
| XLogP | 4.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|