C25H33NO2 — CID 88665225
(2E,4E)-N-(2-methylpropyl)-11-naphthalen-1-yloxyundeca-2,4-dienamide (PubChem CID 88665225) has the molecular formula C25H33NO2 and a molecular weight of 379.54 g/mol. Its IUPAC name is (2E,4E)-N-(2-methylpropyl)-11-naphthalen-1-yloxyundeca-2,4-dienamide.
| Compound Name | (2E,4E)-N-(2-methylpropyl)-11-naphthalen-1-yloxyundeca-2,4-dienamide |
|---|---|
| PubChem CID | 88665225 |
| Molecular Formula | C25H33NO2 |
| Molecular Weight | 379.54 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | (2E,4E)-N-(2-methylpropyl)-11-naphthalen-1-yloxyundeca-2,4-dienamide |
| SMILES | CC(C)CNC(=O)/C=C/C=C/CCCCCCOc1cccc2ccccc12 |
| InChI | InChI=1S/C25H33NO2/c1-21(2)20-26-25(27)18-9-7-5-3-4-6-8-12-19-28-24-17-13-15-22-14-10-11-16-23(22)24/h5,7,9-11,13-18,21H,3-4,6,8,12,19-20H2,1-2H3,(H,26,27)/b7-5+,18-9+ |
| InChIKey | MBQLSELUBLXHNB-JXGVBEJFSA-N |
| XLogP | 6.05 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.54 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|