About 2-pentoxyquinoline;1H-quinazolin-2-one
2-pentoxyquinoline;1H-quinazolin-2-one (PubChem CID 174765854) has the molecular formula C22H23N3O2
and a molecular weight of 361.45 g/mol. Its IUPAC name is 2-pentoxyquinoline;1H-quinazolin-2-one.
Molecular Properties
| Compound Name | 2-pentoxyquinoline;1H-quinazolin-2-one |
| PubChem CID | 174765854 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 2-pentoxyquinoline;1H-quinazolin-2-one |
| SMILES | CCCCCOc1ccc2ccccc2n1.O=c1ncc2ccccc2[nH]1 |
| InChI | InChI=1S/C14H17NO.C8H6N2O/c1-2-3-6-11-16-14-10-9-12-7-4-5-8-13(12)15-14;11-8-9-5-6-3-1-2-4-7(6)10-8/h4-5,7-10H,2-3,6,11H2,1H3;1-5H,(H,9,10,11) |
| InChIKey | PAACIHIECLNSKQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-pentoxyquinoline;1H-quinazolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pentoxyquinoline;1H-quinazolin-2-one?
The IUPAC name of 2-pentoxyquinoline;1H-quinazolin-2-one (CID 174765854) is 2-pentoxyquinoline;1H-quinazolin-2-one.
What is the SMILES notation for 2-pentoxyquinoline;1H-quinazolin-2-one?
The canonical SMILES for 2-pentoxyquinoline;1H-quinazolin-2-one is CCCCCOc1ccc2ccccc2n1.O=c1ncc2ccccc2[nH]1.
What is the InChIKey of 2-pentoxyquinoline;1H-quinazolin-2-one?
The InChIKey is PAACIHIECLNSKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO.C8H6N2O/c1-2-3-6-11-16-14-10-9-12-7-4-5-8-13(12)15-14;11-8-9-5-6-3-1-2-4-7(6)10-8/h4-5,7-10H,2-3,6,11H2,1H3;1-5H,(H,9,10,11).
What are the key properties of 2-pentoxyquinoline;1H-quinazolin-2-one?
2-pentoxyquinoline;1H-quinazolin-2-one has a molecular weight of 361.45 g/mol, XLogP of 4.73, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pentoxyquinoline;1H-quinazolin-2-one is sourced from PubChem (CID 174765854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).