About acetamide;1H-quinazolin-2-one
acetamide;1H-quinazolin-2-one (PubChem CID 141293314) has the molecular formula C10H11N3O2
and a molecular weight of 205.22 g/mol. Its IUPAC name is acetamide;1H-quinazolin-2-one.
Molecular Properties
| Compound Name | acetamide;1H-quinazolin-2-one |
| PubChem CID | 141293314 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | acetamide;1H-quinazolin-2-one |
| SMILES | CC(N)=O.O=c1ncc2ccccc2[nH]1 |
| InChI | InChI=1S/C8H6N2O.C2H5NO/c11-8-9-5-6-3-1-2-4-7(6)10-8;1-2(3)4/h1-5H,(H,9,10,11);1H3,(H2,3,4) |
| InChIKey | OBKHYEQWCCKKIH-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze acetamide;1H-quinazolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetamide;1H-quinazolin-2-one?
The IUPAC name of acetamide;1H-quinazolin-2-one (CID 141293314) is acetamide;1H-quinazolin-2-one.
What is the SMILES notation for acetamide;1H-quinazolin-2-one?
The canonical SMILES for acetamide;1H-quinazolin-2-one is CC(N)=O.O=c1ncc2ccccc2[nH]1.
What is the InChIKey of acetamide;1H-quinazolin-2-one?
The InChIKey is OBKHYEQWCCKKIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O.C2H5NO/c11-8-9-5-6-3-1-2-4-7(6)10-8;1-2(3)4/h1-5H,(H,9,10,11);1H3,(H2,3,4).
What are the key properties of acetamide;1H-quinazolin-2-one?
acetamide;1H-quinazolin-2-one has a molecular weight of 205.22 g/mol, XLogP of 0.41, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetamide;1H-quinazolin-2-one is sourced from PubChem (CID 141293314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).