C14H16N2O2 — CID 70541203
3-pentoxy-1,4-benzodiazepin-2-one (PubChem CID 70541203) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is 3-pentoxy-1,4-benzodiazepin-2-one.
| Compound Name | 3-pentoxy-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 70541203 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 3-pentoxy-1,4-benzodiazepin-2-one |
| SMILES | CCCCCOc1ncc2ccccc2nc1=O |
| InChI | InChI=1S/C14H16N2O2/c1-2-3-6-9-18-14-13(17)16-12-8-5-4-7-11(12)10-15-14/h4-5,7-8,10H,2-3,6,9H2,1H3 |
| InChIKey | ASPGPZBHPIMIIV-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|