C19H36O — CID 123235755
7,11,15-trimethylhexadeca-1,3-dien-8-ol (PubChem CID 123235755) has the molecular formula C19H36O and a molecular weight of 280.50 g/mol. Its IUPAC name is 7,11,15-trimethylhexadeca-1,3-dien-8-ol.
| Compound Name | 7,11,15-trimethylhexadeca-1,3-dien-8-ol |
|---|---|
| PubChem CID | 123235755 |
| Molecular Formula | C19H36O |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.28 |
| IUPAC Name | 7,11,15-trimethylhexadeca-1,3-dien-8-ol |
| SMILES | C=CC=CCCC(C)C(O)CCC(C)CCCC(C)C |
| InChI | InChI=1S/C19H36O/c1-6-7-8-9-13-18(5)19(20)15-14-17(4)12-10-11-16(2)3/h6-8,16-20H,1,9-15H2,2-5H3 |
| InChIKey | DCZMBOKYNMITNS-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|