About (6E)-nona-6,8-dien-1-yn-3-ol
(6E)-nona-6,8-dien-1-yn-3-ol (PubChem CID 15469634) has the molecular formula C9H12O
and a molecular weight of 136.19 g/mol. Its IUPAC name is (6E)-nona-6,8-dien-1-yn-3-ol.
Molecular Properties
| Compound Name | (6E)-nona-6,8-dien-1-yn-3-ol |
| PubChem CID | 15469634 |
| Molecular Formula | C9H12O |
| Molecular Weight | 136.19 g/mol |
| Exact Mass | 136.09 |
| IUPAC Name | (6E)-nona-6,8-dien-1-yn-3-ol |
| SMILES | C#CC(O)CC/C=C/C=C |
| InChI | InChI=1S/C9H12O/c1-3-5-6-7-8-9(10)4-2/h2-3,5-6,9-10H,1,7-8H2/b6-5+ |
| InChIKey | FVQWXKUANNFHBK-AATRIKPKSA-N |
| XLogP | 1.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.19 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (6E)-nona-6,8-dien-1-yn-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6E)-nona-6,8-dien-1-yn-3-ol?
The IUPAC name of (6E)-nona-6,8-dien-1-yn-3-ol (CID 15469634) is (6E)-nona-6,8-dien-1-yn-3-ol.
What is the SMILES notation for (6E)-nona-6,8-dien-1-yn-3-ol?
The canonical SMILES for (6E)-nona-6,8-dien-1-yn-3-ol is C#CC(O)CC/C=C/C=C.
What is the InChIKey of (6E)-nona-6,8-dien-1-yn-3-ol?
The InChIKey is FVQWXKUANNFHBK-AATRIKPKSA-N. The full InChI is InChI=1S/C9H12O/c1-3-5-6-7-8-9(10)4-2/h2-3,5-6,9-10H,1,7-8H2/b6-5+.
What are the key properties of (6E)-nona-6,8-dien-1-yn-3-ol?
(6E)-nona-6,8-dien-1-yn-3-ol has a molecular weight of 136.19 g/mol, XLogP of 1.50, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6E)-nona-6,8-dien-1-yn-3-ol is sourced from PubChem (CID 15469634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).