C16H26S — CID 154245049
7-octa-5,7-dien-2-ylsulfanylocta-1,3-diene (PubChem CID 154245049) has the molecular formula C16H26S and a molecular weight of 250.45 g/mol. Its IUPAC name is 7-octa-5,7-dien-2-ylsulfanylocta-1,3-diene.
| Compound Name | 7-octa-5,7-dien-2-ylsulfanylocta-1,3-diene |
|---|---|
| PubChem CID | 154245049 |
| Molecular Formula | C16H26S |
| Molecular Weight | 250.45 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 7-octa-5,7-dien-2-ylsulfanylocta-1,3-diene |
| SMILES | C=CC=CCCC(C)SC(C)CCC=CC=C |
| InChI | InChI=1S/C16H26S/c1-5-7-9-11-13-15(3)17-16(4)14-12-10-8-6-2/h5-10,15-16H,1-2,11-14H2,3-4H3 |
| InChIKey | GGDAUFOMIYNSOJ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.45 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|