C14H28O3Si — CID 87891599
triethoxy(octa-5,7-dien-2-yl)silane (PubChem CID 87891599) has the molecular formula C14H28O3Si and a molecular weight of 272.46 g/mol. Its IUPAC name is triethoxy(octa-5,7-dien-2-yl)silane.
| Compound Name | triethoxy(octa-5,7-dien-2-yl)silane |
|---|---|
| PubChem CID | 87891599 |
| Molecular Formula | C14H28O3Si |
| Molecular Weight | 272.46 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | triethoxy(octa-5,7-dien-2-yl)silane |
| SMILES | C=CC=CCCC(C)[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C14H28O3Si/c1-6-10-11-12-13-14(5)18(15-7-2,16-8-3)17-9-4/h6,10-11,14H,1,7-9,12-13H2,2-5H3 |
| InChIKey | QSSJQUATAFJARU-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.46 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|