C9H14O2 — CID 153499491
(4E,6Z)-nona-4,6,8-triene-1,1-diol (PubChem CID 153499491) has the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. Its IUPAC name is (4E,6Z)-nona-4,6,8-triene-1,1-diol.
| Compound Name | (4E,6Z)-nona-4,6,8-triene-1,1-diol |
|---|---|
| PubChem CID | 153499491 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | (4E,6Z)-nona-4,6,8-triene-1,1-diol |
| SMILES | C=C/C=C\C=C\CCC(O)O |
| InChI | InChI=1S/C9H14O2/c1-2-3-4-5-6-7-8-9(10)11/h2-6,9-11H,1,7-8H2/b4-3-,6-5+ |
| InChIKey | MPSGCJXFVSSPIM-DNVGVPOPSA-N |
| XLogP | 1.38 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|