C12H19N — CID 166810359
(6Z,8Z)-2-methylundeca-1,6,8,10-tetraen-3-amine (PubChem CID 166810359) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is (6Z,8Z)-2-methylundeca-1,6,8,10-tetraen-3-amine.
| Compound Name | (6Z,8Z)-2-methylundeca-1,6,8,10-tetraen-3-amine |
|---|---|
| PubChem CID | 166810359 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | (6Z,8Z)-2-methylundeca-1,6,8,10-tetraen-3-amine |
| SMILES | C=C/C=C\C=C/CCC(N)C(=C)C |
| InChI | InChI=1S/C12H19N/c1-4-5-6-7-8-9-10-12(13)11(2)3/h4-8,12H,1-2,9-10,13H2,3H3/b6-5-,8-7- |
| InChIKey | QLKOBEWMMLWEJQ-ISTTXYCBSA-N |
| XLogP | 2.97 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|