C9H12O — CID 142221848
(4Z,6Z)-nona-4,6,8-trien-2-one (PubChem CID 142221848) has the molecular formula C9H12O and a molecular weight of 136.19 g/mol. Its IUPAC name is (4Z,6Z)-nona-4,6,8-trien-2-one.
| Compound Name | (4Z,6Z)-nona-4,6,8-trien-2-one |
|---|---|
| PubChem CID | 142221848 |
| Molecular Formula | C9H12O |
| Molecular Weight | 136.19 g/mol |
| Exact Mass | 136.09 |
| IUPAC Name | (4Z,6Z)-nona-4,6,8-trien-2-one |
| SMILES | C=C/C=C\C=C/CC(C)=O |
| InChI | InChI=1S/C9H12O/c1-3-4-5-6-7-8-9(2)10/h3-7H,1,8H2,2H3/b5-4-,7-6- |
| InChIKey | BKOQVFLODJXIFK-RZSVFLSASA-N |
| XLogP | 2.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.19 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|