C7H10O — CID 173388700
(2E,4E)-hepta-2,4,6-trien-2-ol (PubChem CID 173388700) has the molecular formula C7H10O and a molecular weight of 110.16 g/mol. Its IUPAC name is (2E,4E)-hepta-2,4,6-trien-2-ol.
| Compound Name | (2E,4E)-hepta-2,4,6-trien-2-ol |
|---|---|
| PubChem CID | 173388700 |
| Molecular Formula | C7H10O |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.07 |
| IUPAC Name | (2E,4E)-hepta-2,4,6-trien-2-ol |
| SMILES | C=C/C=C/C=C(\C)O |
| InChI | InChI=1S/C7H10O/c1-3-4-5-6-7(2)8/h3-6,8H,1H2,2H3/b5-4+,7-6+ |
| InChIKey | FDFDMVVRQDPWIN-YTXTXJHMSA-N |
| XLogP | 2.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|