C7H9Br — CID 123654102
6-bromohepta-1,3,5-triene (PubChem CID 123654102) has the molecular formula C7H9Br and a molecular weight of 173.05 g/mol. Its IUPAC name is 6-bromohepta-1,3,5-triene.
| Compound Name | 6-bromohepta-1,3,5-triene |
|---|---|
| PubChem CID | 123654102 |
| Molecular Formula | C7H9Br |
| Molecular Weight | 173.05 g/mol |
| Exact Mass | 171.99 |
| IUPAC Name | 6-bromohepta-1,3,5-triene |
| SMILES | C=CC=CC=C(C)Br |
| InChI | InChI=1S/C7H9Br/c1-3-4-5-6-7(2)8/h3-6H,1H2,2H3 |
| InChIKey | BMXOSOWSLZMRCU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.05 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|