About 6-bromohepta-1,3,5-triene
6-bromohepta-1,3,5-triene (PubChem CID 123654102) has the molecular formula C7H9Br
and a molecular weight of 173.05 g/mol. Its IUPAC name is 6-bromohepta-1,3,5-triene.
Molecular Properties
| Compound Name | 6-bromohepta-1,3,5-triene |
| PubChem CID | 123654102 |
| Molecular Formula | C7H9Br |
| Molecular Weight | 173.05 g/mol |
| Exact Mass | 171.99 |
| IUPAC Name | 6-bromohepta-1,3,5-triene |
| SMILES | C=CC=CC=C(C)Br |
| InChI | InChI=1S/C7H9Br/c1-3-4-5-6-7(2)8/h3-6H,1H2,2H3 |
| InChIKey | BMXOSOWSLZMRCU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.05 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 6-bromohepta-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromohepta-1,3,5-triene?
The IUPAC name of 6-bromohepta-1,3,5-triene (CID 123654102) is 6-bromohepta-1,3,5-triene.
What is the SMILES notation for 6-bromohepta-1,3,5-triene?
The canonical SMILES for 6-bromohepta-1,3,5-triene is C=CC=CC=C(C)Br.
What is the InChIKey of 6-bromohepta-1,3,5-triene?
The InChIKey is BMXOSOWSLZMRCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9Br/c1-3-4-5-6-7(2)8/h3-6H,1H2,2H3.
What are the key properties of 6-bromohepta-1,3,5-triene?
6-bromohepta-1,3,5-triene has a molecular weight of 173.05 g/mol, XLogP of 3.03, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromohepta-1,3,5-triene is sourced from PubChem (CID 123654102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).