C8H13NS — CID 142099177
N-[(2E,4Z)-hepta-2,4,6-trien-2-yl]sulfanylmethanamine (PubChem CID 142099177) has the molecular formula C8H13NS and a molecular weight of 155.27 g/mol. Its IUPAC name is N-[(2E,4Z)-hepta-2,4,6-trien-2-yl]sulfanylmethanamine.
| Compound Name | N-[(2E,4Z)-hepta-2,4,6-trien-2-yl]sulfanylmethanamine |
|---|---|
| PubChem CID | 142099177 |
| Molecular Formula | C8H13NS |
| Molecular Weight | 155.27 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | N-[(2E,4Z)-hepta-2,4,6-trien-2-yl]sulfanylmethanamine |
| SMILES | C=C/C=C\C=C(/C)SNC |
| InChI | InChI=1S/C8H13NS/c1-4-5-6-7-8(2)10-9-3/h4-7,9H,1H2,2-3H3/b6-5-,8-7+ |
| InChIKey | LRLKJJKEPVBCOX-IGTJQSIKSA-N |
| XLogP | 2.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.27 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|