C9H14O — CID 89264860
(3E,5Z)-3-methylocta-3,5,7-trien-1-ol (PubChem CID 89264860) has the molecular formula C9H14O and a molecular weight of 138.21 g/mol. Its IUPAC name is (3E,5Z)-3-methylocta-3,5,7-trien-1-ol.
| Compound Name | (3E,5Z)-3-methylocta-3,5,7-trien-1-ol |
|---|---|
| PubChem CID | 89264860 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | (3E,5Z)-3-methylocta-3,5,7-trien-1-ol |
| SMILES | C=C/C=C\C=C(/C)CCO |
| InChI | InChI=1S/C9H14O/c1-3-4-5-6-9(2)7-8-10/h3-6,10H,1,7-8H2,2H3/b5-4-,9-6+ |
| InChIKey | ANLYOQIHPYBUKP-KMOPYBJPSA-N |
| XLogP | 2.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|