C11H17N — CID 144521597
(2E,4Z)-2-methylhepta-2,4,6-trienenitrile;propane (PubChem CID 144521597) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is (2E,4Z)-2-methylhepta-2,4,6-trienenitrile;propane.
| Compound Name | (2E,4Z)-2-methylhepta-2,4,6-trienenitrile;propane |
|---|---|
| PubChem CID | 144521597 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | (2E,4Z)-2-methylhepta-2,4,6-trienenitrile;propane |
| SMILES | C=C/C=C\C=C(/C)C#N.CCC |
| InChI | InChI=1S/C8H9N.C3H8/c1-3-4-5-6-8(2)7-9;1-3-2/h3-6H,1H2,2H3;3H2,1-2H3/b5-4-,8-6+; |
| InChIKey | CFLIHCNKYUGOGZ-NLAQHMENSA-N |
| XLogP | 3.61 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|