C11H19N — CID 142548648
(2E,4Z)-2,6-dimethylhepta-2,4-dienenitrile;ethane (PubChem CID 142548648) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is (2E,4Z)-2,6-dimethylhepta-2,4-dienenitrile;ethane.
| Compound Name | (2E,4Z)-2,6-dimethylhepta-2,4-dienenitrile;ethane |
|---|---|
| PubChem CID | 142548648 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | (2E,4Z)-2,6-dimethylhepta-2,4-dienenitrile;ethane |
| SMILES | C/C(C#N)=C\C=C/C(C)C.CC |
| InChI | InChI=1S/C9H13N.C2H6/c1-8(2)5-4-6-9(3)7-10;1-2/h4-6,8H,1-3H3;1-2H3/b5-4-,9-6+; |
| InChIKey | CCVDSHZBJXMNMR-QKPHYRDRSA-N |
| XLogP | 3.69 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|