About 2,6-dimethylhepta-2,4-dienal
2,6-dimethylhepta-2,4-dienal (PubChem CID 171535580) has the molecular formula C9H14O
and a molecular weight of 138.21 g/mol. Its IUPAC name is 2,6-dimethylhepta-2,4-dienal.
Molecular Properties
| Compound Name | 2,6-dimethylhepta-2,4-dienal |
| PubChem CID | 171535580 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | 2,6-dimethylhepta-2,4-dienal |
| SMILES | CC(C=O)=CC=CC(C)C |
| InChI | InChI=1S/C9H14O/c1-8(2)5-4-6-9(3)7-10/h4-8H,1-3H3 |
| InChIKey | BWKXKNXEIXVQJK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethylhepta-2,4-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethylhepta-2,4-dienal?
The IUPAC name of 2,6-dimethylhepta-2,4-dienal (CID 171535580) is 2,6-dimethylhepta-2,4-dienal.
What is the SMILES notation for 2,6-dimethylhepta-2,4-dienal?
The canonical SMILES for 2,6-dimethylhepta-2,4-dienal is CC(C=O)=CC=CC(C)C.
What is the InChIKey of 2,6-dimethylhepta-2,4-dienal?
The InChIKey is BWKXKNXEIXVQJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O/c1-8(2)5-4-6-9(3)7-10/h4-8H,1-3H3.
What are the key properties of 2,6-dimethylhepta-2,4-dienal?
2,6-dimethylhepta-2,4-dienal has a molecular weight of 138.21 g/mol, XLogP of 2.34, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethylhepta-2,4-dienal is sourced from PubChem (CID 171535580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).