C19H32 — CID 162298747
2,6-dimethylhepta-2,4-diene;2,7-dimethylocta-2,4,6-triene (PubChem CID 162298747) has the molecular formula C19H32 and a molecular weight of 260.46 g/mol. Its IUPAC name is 2,6-dimethylhepta-2,4-diene;2,7-dimethylocta-2,4,6-triene.
| Compound Name | 2,6-dimethylhepta-2,4-diene;2,7-dimethylocta-2,4,6-triene |
|---|---|
| PubChem CID | 162298747 |
| Molecular Formula | C19H32 |
| Molecular Weight | 260.46 g/mol |
| Exact Mass | 260.25 |
| IUPAC Name | 2,6-dimethylhepta-2,4-diene;2,7-dimethylocta-2,4,6-triene |
| SMILES | CC(C)=CC=CC(C)C.CC(C)=CC=CC=C(C)C |
| InChI | InChI=1S/C10H16.C9H16/c1-9(2)7-5-6-8-10(3)4;1-8(2)6-5-7-9(3)4/h5-8H,1-4H3;5-8H,1-4H3 |
| InChIKey | CMWHLAAQVFYOQK-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.46 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|