C13H19Y- — CID 162510504
(4E,8E)-2,10-dimethylundeca-2,4,6,8-tetraene;yttrium (PubChem CID 162510504) has the molecular formula C13H19Y- and a molecular weight of 264.20 g/mol. Its IUPAC name is (4E,8E)-2,10-dimethylundeca-2,4,6,8-tetraene;yttrium.
| Compound Name | (4E,8E)-2,10-dimethylundeca-2,4,6,8-tetraene;yttrium |
|---|---|
| PubChem CID | 162510504 |
| Molecular Formula | C13H19Y- |
| Molecular Weight | 264.20 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | (4E,8E)-2,10-dimethylundeca-2,4,6,8-tetraene;yttrium |
| SMILES | CC(C)=C/C=C/[C-]=C/C=C/C(C)C.[Y] |
| InChI | InChI=1S/C13H19.Y/c1-12(2)10-8-6-5-7-9-11-13(3)4;/h6-12H,1-4H3;/q-1;/b9-7+,10-8+; |
| InChIKey | PSMNZNQEQLKNEN-CXDVKTACSA-N |
| XLogP | 4.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.20 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|