C17H26O — CID 87815383
(3Z)-2,9,13-trimethyltetradeca-3,8,10,12-tetraen-5-one (PubChem CID 87815383) has the molecular formula C17H26O and a molecular weight of 246.39 g/mol. Its IUPAC name is (3Z)-2,9,13-trimethyltetradeca-3,8,10,12-tetraen-5-one.
| Compound Name | (3Z)-2,9,13-trimethyltetradeca-3,8,10,12-tetraen-5-one |
|---|---|
| PubChem CID | 87815383 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | (3Z)-2,9,13-trimethyltetradeca-3,8,10,12-tetraen-5-one |
| SMILES | CC(C)=CC=CC(C)=CCCC(=O)/C=C\C(C)C |
| InChI | InChI=1S/C17H26O/c1-14(2)8-6-9-16(5)10-7-11-17(18)13-12-15(3)4/h6,8-10,12-13,15H,7,11H2,1-5H3/b9-6?,13-12-,16-10? |
| InChIKey | CKMFRVJJMQWUKD-RSSGXLRRSA-N |
| XLogP | 5.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|