C16H26N2O3 — CID 91047472
3,7-dimethylocta-2,4,6-trienyl (2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoate (PubChem CID 91047472) has the molecular formula C16H26N2O3 and a molecular weight of 294.40 g/mol. Its IUPAC name is 3,7-dimethylocta-2,4,6-trienyl (2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoate.
| Compound Name | 3,7-dimethylocta-2,4,6-trienyl (2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoate |
|---|---|
| PubChem CID | 91047472 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 3,7-dimethylocta-2,4,6-trienyl (2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoate |
| SMILES | CC(C)=CC=CC(C)=CCOC(=O)[C@H](C)NC(=O)[C@H](C)N |
| InChI | InChI=1S/C16H26N2O3/c1-11(2)7-6-8-12(3)9-10-21-16(20)14(5)18-15(19)13(4)17/h6-9,13-14H,10,17H2,1-5H3,(H,18,19)/t13-,14-/m0/s1 |
| InChIKey | PCXAEDIKZZPFHD-KBPBESRZSA-N |
| XLogP | 1.85 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|