C24H38N2O3 — CID 11200479
[(3E,5E,7E)-6-methyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-3,5,7-trien-2-yl] (2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoate (PubChem CID 11200479) has the molecular formula C24H38N2O3 and a molecular weight of 402.58 g/mol. Its IUPAC name is [(3E,5E,7E)-6-methyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-3,5,7-trien-2-yl] (2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoate.
| Compound Name | [(3E,5E,7E)-6-methyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-3,5,7-trien-2-yl] (2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoate |
|---|---|
| PubChem CID | 11200479 |
| Molecular Formula | C24H38N2O3 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.29 |
| IUPAC Name | [(3E,5E,7E)-6-methyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-3,5,7-trien-2-yl] (2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoate |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)OC(=O)[C@H](C)NC(=O)[C@H](C)N)C(C)(C)CCC1 |
| InChI | InChI=1S/C24H38N2O3/c1-16(13-14-21-17(2)11-9-15-24(21,6)7)10-8-12-18(3)29-23(28)20(5)26-22(27)19(4)25/h8,10,12-14,18-20H,9,11,15,25H2,1-7H3,(H,26,27)/b12-8+,14-13+,16-10+/t18?,19-,20-/m0/s1 |
| InChIKey | HKVSHVDMGVLFLF-ULOYVIDQSA-N |
| XLogP | 4.36 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|