C25H40N2O — CID 129051313
2-amino-N-[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl]-3-methylbutanamide (PubChem CID 129051313) has the molecular formula C25H40N2O and a molecular weight of 384.61 g/mol. Its IUPAC name is 2-amino-N-[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl]-3-methylbutanamide.
| Compound Name | 2-amino-N-[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 129051313 |
| Molecular Formula | C25H40N2O |
| Molecular Weight | 384.61 g/mol |
| Exact Mass | 384.31 |
| IUPAC Name | 2-amino-N-[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl]-3-methylbutanamide |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/CNC(=O)C(N)C(C)C)C(C)(C)CCC1 |
| InChI | InChI=1S/C25H40N2O/c1-18(2)23(26)24(28)27-17-15-20(4)11-8-10-19(3)13-14-22-21(5)12-9-16-25(22,6)7/h8,10-11,13-15,18,23H,9,12,16-17,26H2,1-7H3,(H,27,28)/b11-8+,14-13+,19-10+,20-15+ |
| InChIKey | BHKWIZHXNKZDRG-FYOPFYCYSA-N |
| XLogP | 5.62 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.61 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|