C24H35NO5 — CID 175184184
(2S)-2-aminobutanedioic acid;(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenal (PubChem CID 175184184) has the molecular formula C24H35NO5 and a molecular weight of 417.55 g/mol. Its IUPAC name is (2S)-2-aminobutanedioic acid;(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenal.
| Compound Name | (2S)-2-aminobutanedioic acid;(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenal |
|---|---|
| PubChem CID | 175184184 |
| Molecular Formula | C24H35NO5 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | (2S)-2-aminobutanedioic acid;(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenal |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C=O)C(C)(C)CCC1.N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C20H28O.C4H7NO4/c1-16(8-6-9-17(2)13-15-21)11-12-19-18(3)10-7-14-20(19,4)5;5-2(4(8)9)1-3(6)7/h6,8-9,11-13,15H,7,10,14H2,1-5H3;2H,1,5H2,(H,6,7)(H,8,9)/b9-6+,12-11+,16-8+,17-13+;/t;2-/m.0/s1 |
| InChIKey | NCHRIRJFIPKKPQ-KNJSVQTQSA-N |
| XLogP | 4.59 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|