C22H35NO4S — CID 87964106
2-aminoethanesulfonic acid;(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenal (PubChem CID 87964106) has the molecular formula C22H35NO4S and a molecular weight of 409.59 g/mol. Its IUPAC name is 2-aminoethanesulfonic acid;(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenal.
| Compound Name | 2-aminoethanesulfonic acid;(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenal |
|---|---|
| PubChem CID | 87964106 |
| Molecular Formula | C22H35NO4S |
| Molecular Weight | 409.59 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | 2-aminoethanesulfonic acid;(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenal |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C=O)C(C)(C)CCC1.NCCS(=O)(=O)O |
| InChI | InChI=1S/C20H28O.C2H7NO3S/c1-16(8-6-9-17(2)13-15-21)11-12-19-18(3)10-7-14-20(19,4)5;3-1-2-7(4,5)6/h6,8-9,11-13,15H,7,10,14H2,1-5H3;1-3H2,(H,4,5,6)/b9-6+,12-11+,16-8+,17-13+; |
| InChIKey | UENBCMLNHYVKJO-FUTAMACOSA-N |
| XLogP | 4.55 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.59 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|