C23H34O — CID 101069451
(2E,4Z,6E)-3,9-dimethyl-7-[(E)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]deca-2,4,6-trienal (PubChem CID 101069451) has the molecular formula C23H34O and a molecular weight of 326.52 g/mol. Its IUPAC name is (2E,4Z,6E)-3,9-dimethyl-7-[(E)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]deca-2,4,6-trienal.
| Compound Name | (2E,4Z,6E)-3,9-dimethyl-7-[(E)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]deca-2,4,6-trienal |
|---|---|
| PubChem CID | 101069451 |
| Molecular Formula | C23H34O |
| Molecular Weight | 326.52 g/mol |
| Exact Mass | 326.26 |
| IUPAC Name | (2E,4Z,6E)-3,9-dimethyl-7-[(E)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]deca-2,4,6-trienal |
| SMILES | CC1=C(/C=C/C(=C/C=C\C(C)=C\C=O)CC(C)C)C(C)(C)CCC1 |
| InChI | InChI=1S/C23H34O/c1-18(2)17-21(11-7-9-19(3)14-16-24)12-13-22-20(4)10-8-15-23(22,5)6/h7,9,11-14,16,18H,8,10,15,17H2,1-6H3/b9-7-,13-12+,19-14+,21-11- |
| InChIKey | SIFSVWUJXINLQY-CENTUUSBSA-N |
| XLogP | 6.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.52 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|