C42H61NO — CID 87281205
1-[[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl]amino]-5,9-dimethyl-11-(2,6,6-trimethylcyclohexen-1-yl)undeca-2,4,6,8,10-pentaen-2-ol (PubChem CID 87281205) has the molecular formula C42H61NO and a molecular weight of 595.96 g/mol. Its IUPAC name is 1-[[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl]amino]-5,9-dimethyl-11-(2,6,6-trimethylcyclohexen-1-yl)undeca-2,4,6,8,10-pentaen-2-ol.
| Compound Name | 1-[[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl]amino]-5,9-dimethyl-11-(2,6,6-trimethylcyclohexen-1-yl)undeca-2,4,6,8,10-pentaen-2-ol |
|---|---|
| PubChem CID | 87281205 |
| Molecular Formula | C42H61NO |
| Molecular Weight | 595.96 g/mol |
| Exact Mass | 595.48 |
| IUPAC Name | 1-[[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl]amino]-5,9-dimethyl-11-(2,6,6-trimethylcyclohexen-1-yl)undeca-2,4,6,8,10-pentaen-2-ol |
| SMILES | CC(C=CC1=C(C)CCCC1(C)C)=CC=CC(C)=CC=C(O)CNCC=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C42H61NO/c1-32(15-11-16-33(2)22-25-39-36(5)19-13-28-41(39,7)8)21-24-38(44)31-43-30-27-35(4)18-12-17-34(3)23-26-40-37(6)20-14-29-42(40,9)10/h11-12,15-18,21-27,43-44H,13-14,19-20,28-31H2,1-10H3 |
| InChIKey | PPAQNZHBIPUPPC-UHFFFAOYSA-N |
| XLogP | 12.08 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.96 |
| LogP ≤ 5 | 12.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|