C27H37N — CID 88754118
N-benzyl-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-amine (PubChem CID 88754118) has the molecular formula C27H37N and a molecular weight of 375.60 g/mol. Its IUPAC name is N-benzyl-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-amine.
| Compound Name | N-benzyl-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-amine |
|---|---|
| PubChem CID | 88754118 |
| Molecular Formula | C27H37N |
| Molecular Weight | 375.60 g/mol |
| Exact Mass | 375.29 |
| IUPAC Name | N-benzyl-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-amine |
| SMILES | CC(C=CC1=C(C)CCCC1(C)C)=CC=CC(C)=CCNCc1ccccc1 |
| InChI | InChI=1S/C27H37N/c1-22(16-17-26-24(3)13-10-19-27(26,4)5)11-9-12-23(2)18-20-28-21-25-14-7-6-8-15-25/h6-9,11-12,14-18,28H,10,13,19-21H2,1-5H3 |
| InChIKey | WMOACJSWTQPLQS-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.60 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|