C21H28 — CID 140698386
[(2Z,4E)-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-dienyl]benzene (PubChem CID 140698386) has the molecular formula C21H28 and a molecular weight of 280.45 g/mol. Its IUPAC name is [(2Z,4E)-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-dienyl]benzene.
| Compound Name | [(2Z,4E)-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-dienyl]benzene |
|---|---|
| PubChem CID | 140698386 |
| Molecular Formula | C21H28 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | [(2Z,4E)-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-dienyl]benzene |
| SMILES | CC1=C(/C=C/C(C)=C\Cc2ccccc2)C(C)(C)CCC1 |
| InChI | InChI=1S/C21H28/c1-17(12-14-19-10-6-5-7-11-19)13-15-20-18(2)9-8-16-21(20,3)4/h5-7,10-13,15H,8-9,14,16H2,1-4H3/b15-13+,17-12- |
| InChIKey | RCOXHHNTDZCMEO-GUHVBPMFSA-N |
| XLogP | 6.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|