C26H34O3S — CID 173449342
1-(benzenesulfonyl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6,8-trien-1-one (PubChem CID 173449342) has the molecular formula C26H34O3S and a molecular weight of 426.62 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6,8-trien-1-one.
| Compound Name | 1-(benzenesulfonyl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6,8-trien-1-one |
|---|---|
| PubChem CID | 173449342 |
| Molecular Formula | C26H34O3S |
| Molecular Weight | 426.62 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 1-(benzenesulfonyl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6,8-trien-1-one |
| SMILES | CC(C=CC1=C(C)CCCC1(C)C)=CCCC(C)=CC(=O)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H34O3S/c1-20(16-17-24-22(3)13-10-18-26(24,4)5)11-9-12-21(2)19-25(27)30(28,29)23-14-7-6-8-15-23/h6-8,11,14-17,19H,9-10,12-13,18H2,1-5H3 |
| InChIKey | NZKYFAIZEJLXKW-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.62 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|