C40H58 — CID 155926577
1,3,3-trimethyl-2-[(1E,3E,5Z,7E,9E,11E,15E,17E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-1,3,5,7,9,11,15,17-octaenyl]cyclohexene (PubChem CID 155926577) has the molecular formula C40H58 and a molecular weight of 538.90 g/mol. Its IUPAC name is 1,3,3-trimethyl-2-[(1E,3E,5Z,7E,9E,11E,15E,17E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-1,3,5,7,9,11,15,17-octaenyl]cyclohexene.
| Compound Name | 1,3,3-trimethyl-2-[(1E,3E,5Z,7E,9E,11E,15E,17E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-1,3,5,7,9,11,15,17-octaenyl]cyclohexene |
|---|---|
| PubChem CID | 155926577 |
| Molecular Formula | C40H58 |
| Molecular Weight | 538.90 g/mol |
| Exact Mass | 538.45 |
| IUPAC Name | 1,3,3-trimethyl-2-[(1E,3E,5Z,7E,9E,11E,15E,17E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-1,3,5,7,9,11,15,17-octaenyl]cyclohexene |
| SMILES | CC1=C(/C=C/C(C)=C/C=C\C(C)=C\C=C\C=C(/C)CC/C=C(C)/C=C/C2=C(C)CCCC2(C)C)C(C)(C)CCC1 |
| InChI | InChI=1S/C40H58/c1-31(19-13-21-33(3)25-27-37-35(5)23-15-29-39(37,7)8)17-11-12-18-32(2)20-14-22-34(4)26-28-38-36(6)24-16-30-40(38,9)10/h11-13,17-19,21-22,25-28H,14-16,20,23-24,29-30H2,1-10H3/b12-11+,19-13-,27-25+,28-26+,31-17+,32-18+,33-21+,34-22+ |
| InChIKey | GFXSVHBNRZHLGG-LXIKQNRGSA-N |
| XLogP | 12.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.90 |
| LogP ≤ 5 | 12.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|