C40H60 — CID 171392462
1,3,3-trimethyl-2-[(1E,3E,7E,9E,11E,15E,17Z)-3,7,12,16-tetramethyl-18-[(1R)-2,6,6-trimethylcyclohex-2-en-1-yl]octadeca-1,3,7,9,11,15,17-heptaenyl]cyclohexene (PubChem CID 171392462) has the molecular formula C40H60 and a molecular weight of 540.92 g/mol. Its IUPAC name is 1,3,3-trimethyl-2-[(1E,3E,7E,9E,11E,15E,17Z)-3,7,12,16-tetramethyl-18-[(1R)-2,6,6-trimethylcyclohex-2-en-1-yl]octadeca-1,3,7,9,11,15,17-heptaenyl]cyclohexene.
| Compound Name | 1,3,3-trimethyl-2-[(1E,3E,7E,9E,11E,15E,17Z)-3,7,12,16-tetramethyl-18-[(1R)-2,6,6-trimethylcyclohex-2-en-1-yl]octadeca-1,3,7,9,11,15,17-heptaenyl]cyclohexene |
|---|---|
| PubChem CID | 171392462 |
| Molecular Formula | C40H60 |
| Molecular Weight | 540.92 g/mol |
| Exact Mass | 540.47 |
| IUPAC Name | 1,3,3-trimethyl-2-[(1E,3E,7E,9E,11E,15E,17Z)-3,7,12,16-tetramethyl-18-[(1R)-2,6,6-trimethylcyclohex-2-en-1-yl]octadeca-1,3,7,9,11,15,17-heptaenyl]cyclohexene |
| SMILES | CC1=CCCC(C)(C)[C@H]1/C=C\C(C)=C\CC/C(C)=C/C=C/C=C(\C)CC/C=C(C)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C40H60/c1-31(19-13-21-33(3)25-27-37-35(5)23-15-29-39(37,7)8)17-11-12-18-32(2)20-14-22-34(4)26-28-38-36(6)24-16-30-40(38,9)10/h11-12,17-18,21-23,25-28,37H,13-16,19-20,24,29-30H2,1-10H3/b12-11+,27-25-,28-26+,31-17+,32-18+,33-21+,34-22+/t37-/m0/s1 |
| InChIKey | YSOZCIMMVFEVRT-BYKAJWFFSA-N |
| XLogP | 12.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.92 |
| LogP ≤ 5 | 12.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|