C24H36O4 — CID 158043135
(E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoic acid;(E)-3-(2,6,6-trimethylcyclohex-2-en-1-yl)prop-2-enoic acid (PubChem CID 158043135) has the molecular formula C24H36O4 and a molecular weight of 388.55 g/mol. Its IUPAC name is (E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoic acid;(E)-3-(2,6,6-trimethylcyclohex-2-en-1-yl)prop-2-enoic acid.
| Compound Name | (E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoic acid;(E)-3-(2,6,6-trimethylcyclohex-2-en-1-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 158043135 |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | (E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoic acid;(E)-3-(2,6,6-trimethylcyclohex-2-en-1-yl)prop-2-enoic acid |
| SMILES | CC1=C(/C=C/C(=O)O)C(C)(C)CCC1.CC1=CCCC(C)(C)C1/C=C/C(=O)O |
| InChI | InChI=1S/2C12H18O2/c2*1-9-5-4-8-12(2,3)10(9)6-7-11(13)14/h6-7H,4-5,8H2,1-3H3,(H,13,14);5-7,10H,4,8H2,1-3H3,(H,13,14)/b2*7-6+ |
| InChIKey | FIPCNIMSIVNEHA-YIKKBJQVSA-N |
| XLogP | 6.16 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|