C40H64 — CID 155920491
1,3,3-trimethyl-2-[(1E,3E,5E,9Z,17E)-3,7,12,16-tetramethyl-18-[(1R)-2,6,6-trimethylcyclohex-2-en-1-yl]octadeca-1,3,5,9,17-pentaenyl]cyclohexene (PubChem CID 155920491) has the molecular formula C40H64 and a molecular weight of 544.95 g/mol. Its IUPAC name is 1,3,3-trimethyl-2-[(1E,3E,5E,9Z,17E)-3,7,12,16-tetramethyl-18-[(1R)-2,6,6-trimethylcyclohex-2-en-1-yl]octadeca-1,3,5,9,17-pentaenyl]cyclohexene.
| Compound Name | 1,3,3-trimethyl-2-[(1E,3E,5E,9Z,17E)-3,7,12,16-tetramethyl-18-[(1R)-2,6,6-trimethylcyclohex-2-en-1-yl]octadeca-1,3,5,9,17-pentaenyl]cyclohexene |
|---|---|
| PubChem CID | 155920491 |
| Molecular Formula | C40H64 |
| Molecular Weight | 544.95 g/mol |
| Exact Mass | 544.50 |
| IUPAC Name | 1,3,3-trimethyl-2-[(1E,3E,5E,9Z,17E)-3,7,12,16-tetramethyl-18-[(1R)-2,6,6-trimethylcyclohex-2-en-1-yl]octadeca-1,3,5,9,17-pentaenyl]cyclohexene |
| SMILES | CC1=CCCC(C)(C)[C@H]1/C=C/C(C)CCCC(C)C/C=C\CC(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C40H64/c1-31(19-13-21-33(3)25-27-37-35(5)23-15-29-39(37,7)8)17-11-12-18-32(2)20-14-22-34(4)26-28-38-36(6)24-16-30-40(38,9)10/h11-13,19,21,24-28,31-32,34,38H,14-18,20,22-23,29-30H2,1-10H3/b12-11-,19-13+,27-25+,28-26+,33-21+/t31?,32?,34?,38-/m0/s1 |
| InChIKey | YZPQNYCOQYJPKD-GQBKRGTCSA-N |
| XLogP | 12.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.95 |
| LogP ≤ 5 | 12.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|