C19H30O2 — CID 11150459
(4E,6E,8E)-7-methyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-4,6,8-triene-1,3-diol (PubChem CID 11150459) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is (4E,6E,8E)-7-methyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-4,6,8-triene-1,3-diol.
| Compound Name | (4E,6E,8E)-7-methyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-4,6,8-triene-1,3-diol |
|---|---|
| PubChem CID | 11150459 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | (4E,6E,8E)-7-methyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-4,6,8-triene-1,3-diol |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(O)CCO)C(C)(C)CCC1 |
| InChI | InChI=1S/C19H30O2/c1-15(7-5-9-17(21)12-14-20)10-11-18-16(2)8-6-13-19(18,3)4/h5,7,9-11,17,20-21H,6,8,12-14H2,1-4H3/b9-5+,11-10+,15-7+ |
| InChIKey | FRYZYHSOBQPDTL-PBEPTZCYSA-N |
| XLogP | 4.32 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|