C60H110O2 — CID 25144202
2-[(1E,3Z,5E,7Z)-3,7-dimethyl-9,9-bis(3,7,11,15-tetramethylhexadecoxy)nona-1,3,5,7-tetraenyl]-1,3,3-trimethylcyclohexene (PubChem CID 25144202) has the molecular formula C60H110O2 and a molecular weight of 863.54 g/mol. Its IUPAC name is 2-[(1E,3Z,5E,7Z)-3,7-dimethyl-9,9-bis(3,7,11,15-tetramethylhexadecoxy)nona-1,3,5,7-tetraenyl]-1,3,3-trimethylcyclohexene.
| Compound Name | 2-[(1E,3Z,5E,7Z)-3,7-dimethyl-9,9-bis(3,7,11,15-tetramethylhexadecoxy)nona-1,3,5,7-tetraenyl]-1,3,3-trimethylcyclohexene |
|---|---|
| PubChem CID | 25144202 |
| Molecular Formula | C60H110O2 |
| Molecular Weight | 863.54 g/mol |
| Exact Mass | 862.85 |
| IUPAC Name | 2-[(1E,3Z,5E,7Z)-3,7-dimethyl-9,9-bis(3,7,11,15-tetramethylhexadecoxy)nona-1,3,5,7-tetraenyl]-1,3,3-trimethylcyclohexene |
| SMILES | CC1=C(/C=C/C(C)=C\C=C\C(C)=C/C(OCCC(C)CCCC(C)CCCC(C)CCCC(C)C)OCCC(C)CCCC(C)CCCC(C)CCCC(C)C)C(C)(C)CCC1 |
| InChI | InChI=1S/C60H110O2/c1-47(2)24-16-26-49(5)28-18-30-51(7)32-20-35-54(10)41-44-61-59(46-56(12)37-22-34-53(9)39-40-58-57(13)38-23-43-60(58,14)15)62-45-42-55(11)36-21-33-52(8)31-19-29-50(6)27-17-25-48(3)4/h22,34,37,39-40,46-52,54-55,59H,16-21,23-33,35-36,38,41-45H2,1-15H3/b37-22+,40-39+,53-34-,56-46- |
| InChIKey | RYFNFEZTJVWMCD-FDYAYHDYSA-N |
| XLogP | 19.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.54 |
| LogP ≤ 5 | 19.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|