C41H58 — CID 175976636
1,4,5,5-tetramethyl-6-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]cyclohexene (PubChem CID 175976636) has the molecular formula C41H58 and a molecular weight of 550.92 g/mol. Its IUPAC name is 1,4,5,5-tetramethyl-6-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]cyclohexene.
| Compound Name | 1,4,5,5-tetramethyl-6-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]cyclohexene |
|---|---|
| PubChem CID | 175976636 |
| Molecular Formula | C41H58 |
| Molecular Weight | 550.92 g/mol |
| Exact Mass | 550.45 |
| IUPAC Name | 1,4,5,5-tetramethyl-6-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]cyclohexene |
| SMILES | CC1=CCC(C)C(C)(C)C1/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C41H58/c1-31(19-14-21-33(3)24-28-38-35(5)23-16-30-40(38,8)9)17-12-13-18-32(2)20-15-22-34(4)25-29-39-36(6)26-27-37(7)41(39,10)11/h12-15,17-22,24-26,28-29,37,39H,16,23,27,30H2,1-11H3/b13-12+,19-14+,20-15+,28-24+,29-25+,31-17+,32-18+,33-21+,34-22+ |
| InChIKey | NXXDYRWTUFZILL-CCGHNVGYSA-N |
| XLogP | 12.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.92 |
| LogP ≤ 5 | 12.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|