C41H60 — CID 149189304
1,3,3-trimethyl-2-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-3,7,12,16-tetramethyl-18-(2,2,6,6-tetramethylcyclohexyl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]cyclohexene (PubChem CID 149189304) has the molecular formula C41H60 and a molecular weight of 552.93 g/mol. Its IUPAC name is 1,3,3-trimethyl-2-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-3,7,12,16-tetramethyl-18-(2,2,6,6-tetramethylcyclohexyl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]cyclohexene.
| Compound Name | 1,3,3-trimethyl-2-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-3,7,12,16-tetramethyl-18-(2,2,6,6-tetramethylcyclohexyl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]cyclohexene |
|---|---|
| PubChem CID | 149189304 |
| Molecular Formula | C41H60 |
| Molecular Weight | 552.93 g/mol |
| Exact Mass | 552.47 |
| IUPAC Name | 1,3,3-trimethyl-2-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-3,7,12,16-tetramethyl-18-(2,2,6,6-tetramethylcyclohexyl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]cyclohexene |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C2C(C)(C)CCCC2(C)C)C(C)(C)CCC1 |
| InChI | InChI=1S/C41H60/c1-32(20-14-22-34(3)25-27-37-36(5)24-16-29-39(37,6)7)18-12-13-19-33(2)21-15-23-35(4)26-28-38-40(8,9)30-17-31-41(38,10)11/h12-15,18-23,25-28,38H,16-17,24,29-31H2,1-11H3/b13-12+,20-14+,21-15+,27-25+,28-26+,32-18+,33-19+,34-22+,35-23+ |
| InChIKey | XCMVPJVLFBZWTC-ZGTFXLLPSA-N |
| XLogP | 12.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.93 |
| LogP ≤ 5 | 12.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|