C76H88O4P2S — CID 154706675
bis([(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl]-triphenylphosphanium);sulfate (PubChem CID 154706675) has the molecular formula C76H88O4P2S and a molecular weight of 1159.55 g/mol. Its IUPAC name is bis([(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl]-triphenylphosphanium);sulfate.
| Compound Name | bis([(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl]-triphenylphosphanium);sulfate |
|---|---|
| PubChem CID | 154706675 |
| Molecular Formula | C76H88O4P2S |
| Molecular Weight | 1159.55 g/mol |
| Exact Mass | 1158.59 |
| IUPAC Name | bis([(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl]-triphenylphosphanium);sulfate |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)C(C)(C)CCC1.CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)C(C)(C)CCC1.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/2C38H44P.H2O4S/c2*1-31(26-27-37-33(3)19-16-29-38(37,4)5)17-15-18-32(2)28-30-39(34-20-9-6-10-21-34,35-22-11-7-12-23-35)36-24-13-8-14-25-36;1-5(2,3)4/h2*6-15,17-18,20-28H,16,19,29-30H2,1-5H3;(H2,1,2,3,4)/q2*+1;/p-2/b2*18-15+,27-26+,31-17+,32-28+; |
| InChIKey | QWTPKKWCCIJQKB-TWIIOSCISA-L |
| XLogP | 17.69 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 83 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1159.55 |
| LogP ≤ 5 | 17.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|