C27H36O3S — CID 122605086
[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] 4-methylbenzenesulfonate (PubChem CID 122605086) has the molecular formula C27H36O3S and a molecular weight of 440.65 g/mol. Its IUPAC name is [(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] 4-methylbenzenesulfonate.
| Compound Name | [(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 122605086 |
| Molecular Formula | C27H36O3S |
| Molecular Weight | 440.65 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | [(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] 4-methylbenzenesulfonate |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/COS(=O)(=O)c2ccc(C)cc2)C(C)(C)CCC1 |
| InChI | InChI=1S/C27H36O3S/c1-21(14-17-26-24(4)11-8-19-27(26,5)6)9-7-10-22(2)18-20-30-31(28,29)25-15-12-23(3)13-16-25/h7,9-10,12-18H,8,11,19-20H2,1-6H3/b10-7+,17-14+,21-9+,22-18+ |
| InChIKey | ZJZLJAAPFQYXHH-JDPLCJFASA-N |
| XLogP | 7.23 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.65 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|