C43H62O — CID 54011976
2-[11-[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoxy]-3,7,10-trimethylundeca-1,3,5,7,9-pentaenyl]-1,3,3-trimethylcyclohexene (PubChem CID 54011976) has the molecular formula C43H62O and a molecular weight of 594.97 g/mol. Its IUPAC name is 2-[11-[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoxy]-3,7,10-trimethylundeca-1,3,5,7,9-pentaenyl]-1,3,3-trimethylcyclohexene.
| Compound Name | 2-[11-[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoxy]-3,7,10-trimethylundeca-1,3,5,7,9-pentaenyl]-1,3,3-trimethylcyclohexene |
|---|---|
| PubChem CID | 54011976 |
| Molecular Formula | C43H62O |
| Molecular Weight | 594.97 g/mol |
| Exact Mass | 594.48 |
| IUPAC Name | 2-[11-[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoxy]-3,7,10-trimethylundeca-1,3,5,7,9-pentaenyl]-1,3,3-trimethylcyclohexene |
| SMILES | CC(C=CC1=C(C)CCCC1(C)C)=CC=CC(C)=CC=C(C)COCC=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C43H62O/c1-33(16-12-17-34(2)24-26-40-38(6)20-14-29-42(40,8)9)22-23-37(5)32-44-31-28-36(4)19-13-18-35(3)25-27-41-39(7)21-15-30-43(41,10)11/h12-13,16-19,22-28H,14-15,20-21,29-32H2,1-11H3 |
| InChIKey | KSZMSAGYIKGXND-UHFFFAOYSA-N |
| XLogP | 13.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.97 |
| LogP ≤ 5 | 13.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|