C27H36O2S — CID 85371560
1-[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl]sulfonyl-4-methylbenzene (PubChem CID 85371560) has the molecular formula C27H36O2S and a molecular weight of 424.65 g/mol. Its IUPAC name is 1-[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl]sulfonyl-4-methylbenzene.
| Compound Name | 1-[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl]sulfonyl-4-methylbenzene |
|---|---|
| PubChem CID | 85371560 |
| Molecular Formula | C27H36O2S |
| Molecular Weight | 424.65 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | 1-[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl]sulfonyl-4-methylbenzene |
| SMILES | CC(C=CC1=C(C)CCCC1(C)C)=CC=CC(C)=CCS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C27H36O2S/c1-21(14-17-26-24(4)11-8-19-27(26,5)6)9-7-10-22(2)18-20-30(28,29)25-15-12-23(3)13-16-25/h7,9-10,12-18H,8,11,19-20H2,1-6H3 |
| InChIKey | FQCFITANYVMEGE-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.65 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|