C26H41NO2 — CID 164913356
2-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl]amino]-4-methylpentanoic acid (PubChem CID 164913356) has the molecular formula C26H41NO2 and a molecular weight of 399.62 g/mol. Its IUPAC name is 2-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 164913356 |
| Molecular Formula | C26H41NO2 |
| Molecular Weight | 399.62 g/mol |
| Exact Mass | 399.31 |
| IUPAC Name | 2-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl]amino]-4-methylpentanoic acid |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/CNC(CC(C)C)C(=O)O)C(C)(C)CCC1 |
| InChI | InChI=1S/C26H41NO2/c1-19(2)18-24(25(28)29)27-17-15-21(4)11-8-10-20(3)13-14-23-22(5)12-9-16-26(23,6)7/h8,10-11,13-15,19,24,27H,9,12,16-18H2,1-7H3,(H,28,29)/b11-8+,14-13+,20-10+,21-15+ |
| InChIKey | GMPUOQPEJGUABE-LSGZNLPKSA-N |
| XLogP | 6.61 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.62 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|