C24H37NO — CID 163532942
1-[[(3E,5E,7E,9E)-4,8-dimethyl-10-(2,6,6-trimethylcyclohexen-1-yl)deca-3,5,7,9-tetraen-2-yl]amino]propan-2-one (PubChem CID 163532942) has the molecular formula C24H37NO and a molecular weight of 355.57 g/mol. Its IUPAC name is 1-[[(3E,5E,7E,9E)-4,8-dimethyl-10-(2,6,6-trimethylcyclohexen-1-yl)deca-3,5,7,9-tetraen-2-yl]amino]propan-2-one.
| Compound Name | 1-[[(3E,5E,7E,9E)-4,8-dimethyl-10-(2,6,6-trimethylcyclohexen-1-yl)deca-3,5,7,9-tetraen-2-yl]amino]propan-2-one |
|---|---|
| PubChem CID | 163532942 |
| Molecular Formula | C24H37NO |
| Molecular Weight | 355.57 g/mol |
| Exact Mass | 355.29 |
| IUPAC Name | 1-[[(3E,5E,7E,9E)-4,8-dimethyl-10-(2,6,6-trimethylcyclohexen-1-yl)deca-3,5,7,9-tetraen-2-yl]amino]propan-2-one |
| SMILES | CC(=O)CNC(C)/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C24H37NO/c1-18(13-14-23-20(3)12-9-15-24(23,6)7)10-8-11-19(2)16-21(4)25-17-22(5)26/h8,10-11,13-14,16,21,25H,9,12,15,17H2,1-7H3/b11-8+,14-13+,18-10+,19-16+ |
| InChIKey | DUNPWIIZRNLYHK-DXJCHIHNSA-N |
| XLogP | 6.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.57 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|